BDBM18826 (2E)-4-(4-hexylphenyl)-4-oxobut-2-enoic acid::Enone, 4a
SMILES CCCCCCc1ccc(cc1)C(=O)\C=C\C(O)=O
InChI Key InChIKey=HKEVTQICMJNUNY-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 18826
Affinity DataIC50: 1.92E+4nMpH: 7.2 T: 2°CAssay Description:IC50 is the concentration of each compound required to inhibit 50% of the binding between the TR LBD and the SRC2-2 peptide using fluorescence polari...More data for this Ligand-Target Pair
Affinity DataIC50: 1.77E+4nMAssay Description:IC50 is the concentration of each compound required to inhibit 50% of the binding between the TR LBD and the SRC2-2 peptide using fluorescence polari...More data for this Ligand-Target Pair