BDBM703922 N-[(6-amino-8-methyl-1,5-naphthyridin-3- yl)methyl]-6-hydroxy-pyrimidine-4- carboxamide. LCMS [M + 1]+ = 311.1. 1H NMR (400 MHz, CD3OD) $#948; = 8.81 (d, J = 1.6 Hz, 1H), 8.32 (s, 1H), 7.99 (d, J = 1.6 Hz, 1H), 7.13 (d, J = 1.2 Hz, 1H), 7.10 (s, 1H), 4.78 (s, 2H), 2.75 (d, J = 1.2 Hz, 3H).::US20240368153, Example 7-3
SMILES Cc1cc(N)nc2cc(CNC(=O)c3cc(O)ncn3)cnc12
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 703922
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent