BDBM703895 2-((6-amino-8-methyl-1,5-naphthyridin-3- yl)methyl)benzonitrile. LCMS [M + 1]: 275.2. 1H NMR (400 MHz, MeOD-d4) $#948; = 8.51 (d, J = 2.0 Hz, 1H), 7.77 (d, J = 7.6 Hz, 1H), 7.71-7.63 (m, 2H), 7.56 (d, J = 7.8 Hz, 1H), 7.49-7.42 (m, 1H), 6.90 (d, J = 0.8 Hz, 1H), 4.40 (s, 2H), 2.62 (d, J = 1.2 Hz, 3H).::US20240368153, Example 2-4
SMILES Cc1cc(N)nc2cc(Cc3ccccc3C#N)cnc12
InChI Key
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 5 hits for monomerid = 703895
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent
TargetProtein arginine N-methyltransferase 5 (PRMT5) and Methylosome protein WDR77 (MEP-50)(Human)
Mirati Therapeutics
US Patent
Mirati Therapeutics
US Patent