BDBM571546 US11446301, Compound 3
SMILES CC(Nc1nc(N)nc(N)c1C#N)c1cc2ccc(F)cc2nc1-c1cc(F)cc(F)c1
InChI Key InChIKey=BURKTZPDFXCKEB-UHFFFAOYSA-N
Data 1 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 1 hit for monomerid = 571546
TargetPhosphatidylinositol 4,5-bisphosphate 3-kinase catalytic subunit delta isoform(Human)
Nanjing Zhengxiang Pharmaceuticals
US Patent
Nanjing Zhengxiang Pharmaceuticals
US Patent
Affinity DataIC50: 0.240nMAssay Description:The TR-FRET assay can monitor formation of the product 3,4,5-inositol triphosphate molecule (PIP3) as it competed with fluorescently labeled PIP3 for...More data for this Ligand-Target Pair