BDBM558233 US11365192, Example 18-4
SMILES OC(=O)c1cnc(cn1)-c1cccc(COc2ccc(nc2)-c2ccn[nH]2)c1
InChI Key InChIKey=AETOVNZIRSHXPU-UHFFFAOYSA-N
Data 2 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 2 hits for monomerid = 558233
Affinity DataIC50: 490nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair
Affinity DataIC50: 22nMAssay Description:In the CYP4F2 inhibition test, the reaction solution containing each compound [final concentration of 50 mM, KPO4 (pH 7.4), 2.5 μM luciferine de...More data for this Ligand-Target Pair