BDBM159294 US10093663, Example 8::US9682968, Example-8
SMILES Cc1cc(C)c2[nH]ccc2c1CN1CCCCC1c1ccc(cc1)C(N)=O
InChI Key InChIKey=HVCYKNQNKTXZHC-UHFFFAOYSA-N
Data 3 IC50
Activity Spreadsheet -- Enzyme Inhibition Constant Data from BindingDB
Found 3 hits for monomerid = 159294
Affinity DataIC50: 0.710nMAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 uM), recombinant human complement factor B (expressed in drosophila cells and purified us...More data for this Ligand-Target Pair
Affinity DataIC50: 710nMpH: 7.4 T: 2°CAssay Description:CVF-Bb complex prepared from purified cobra venom factor (1 μM), recombinant human complement factor B (expressed in drosophila cells and purifi...More data for this Ligand-Target Pair
Affinity DataIC50: 710nMAssay Description:Inhibition of human serine protease factor B by TR-FRET based competition binding assayMore data for this Ligand-Target Pair